C19H14N2O2S — CID 55785711
N-(1-benzothiophen-3-ylmethyl)-3-phenyl-1,2-oxazole-5-carboxamide (PubChem CID 55785711) has the molecular formula C19H14N2O2S and a molecular weight of 334.40 g/mol. Its IUPAC name is N-(1-benzothiophen-3-ylmethyl)-3-phenyl-1,2-oxazole-5-carboxamide.
| Compound Name | N-(1-benzothiophen-3-ylmethyl)-3-phenyl-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 55785711 |
| Molecular Formula | C19H14N2O2S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | N-(1-benzothiophen-3-ylmethyl)-3-phenyl-1,2-oxazole-5-carboxamide |
| SMILES | O=C(NCc1csc2ccccc12)c1cc(-c2ccccc2)no1 |
| InChI | InChI=1S/C19H14N2O2S/c22-19(17-10-16(21-23-17)13-6-2-1-3-7-13)20-11-14-12-24-18-9-5-4-8-15(14)18/h1-10,12H,11H2,(H,20,22) |
| InChIKey | LAIXWEBQJUDSAK-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |