C14H11NO2S2 — CID 166202482
N-(1-benzothiophen-3-ylmethyl)-4-hydroxythiophene-2-carboxamide (PubChem CID 166202482) has the molecular formula C14H11NO2S2 and a molecular weight of 289.38 g/mol. Its IUPAC name is N-(1-benzothiophen-3-ylmethyl)-4-hydroxythiophene-2-carboxamide.
| Compound Name | N-(1-benzothiophen-3-ylmethyl)-4-hydroxythiophene-2-carboxamide |
|---|---|
| PubChem CID | 166202482 |
| Molecular Formula | C14H11NO2S2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.02 |
| IUPAC Name | N-(1-benzothiophen-3-ylmethyl)-4-hydroxythiophene-2-carboxamide |
| SMILES | O=C(NCc1csc2ccccc12)c1cc(O)cs1 |
| InChI | InChI=1S/C14H11NO2S2/c16-10-5-13(19-8-10)14(17)15-6-9-7-18-12-4-2-1-3-11(9)12/h1-5,7-8,16H,6H2,(H,15,17) |
| InChIKey | OFSWSSOROYPFMG-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'} |
|---|