C19H17F3N2O2S — CID 55786011
N-cyclopropyl-4-methyl-3-[[4-(trifluoromethylsulfanyl)benzoyl]amino]benzamide (PubChem CID 55786011) has the molecular formula C19H17F3N2O2S and a molecular weight of 394.42 g/mol. Its IUPAC name is N-cyclopropyl-4-methyl-3-[[4-(trifluoromethylsulfanyl)benzoyl]amino]benzamide.
| Compound Name | N-cyclopropyl-4-methyl-3-[[4-(trifluoromethylsulfanyl)benzoyl]amino]benzamide |
|---|---|
| PubChem CID | 55786011 |
| Molecular Formula | C19H17F3N2O2S |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | N-cyclopropyl-4-methyl-3-[[4-(trifluoromethylsulfanyl)benzoyl]amino]benzamide |
| SMILES | Cc1ccc(C(=O)NC2CC2)cc1NC(=O)c1ccc(SC(F)(F)F)cc1 |
| InChI | InChI=1S/C19H17F3N2O2S/c1-11-2-3-13(18(26)23-14-6-7-14)10-16(11)24-17(25)12-4-8-15(9-5-12)27-19(20,21)22/h2-5,8-10,14H,6-7H2,1H3,(H,23,26)(H,24,25) |
| InChIKey | OAMLQSFKUZXDFU-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |