C22H25N5O3S — CID 55786213
N-[6-(2,6-dimethylmorpholin-4-yl)-3-pyridinyl]-4-methyl-2-oxo-6-thia-1,8-diazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-triene-5-carboxamide (PubChem CID 55786213) has the molecular formula C22H25N5O3S and a molecular weight of 439.54 g/mol. Its IUPAC name is N-[6-(2,6-dimethylmorpholin-4-yl)-3-pyridinyl]-4-methyl-2-oxo-6-thia-1,8-diazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-triene-5-carboxamide.
| Compound Name | N-[6-(2,6-dimethylmorpholin-4-yl)-3-pyridinyl]-4-methyl-2-oxo-6-thia-1,8-diazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-triene-5-carboxamide |
|---|---|
| PubChem CID | 55786213 |
| Molecular Formula | C22H25N5O3S |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | N-[6-(2,6-dimethylmorpholin-4-yl)-3-pyridinyl]-4-methyl-2-oxo-6-thia-1,8-diazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-triene-5-carboxamide |
| SMILES | Cc1c(C(=O)Nc2ccc(N3CC(C)OC(C)C3)nc2)sc2nc3n(c(=O)c12)CCC3 |
| InChI | InChI=1S/C22H25N5O3S/c1-12-10-26(11-13(2)30-12)16-7-6-15(9-23-16)24-20(28)19-14(3)18-21(31-19)25-17-5-4-8-27(17)22(18)29/h6-7,9,12-13H,4-5,8,10-11H2,1-3H3,(H,24,28) |
| InChIKey | QOYSXARATUQLMK-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |