C24H18N4O3S — CID 55788748
methyl 3-[2-[3-[[2-(1-methylpyrazol-4-yl)-1,3-thiazole-4-carbonyl]amino]phenyl]ethynyl]benzoate (PubChem CID 55788748) has the molecular formula C24H18N4O3S and a molecular weight of 442.50 g/mol. Its IUPAC name is methyl 3-[2-[3-[[2-(1-methylpyrazol-4-yl)-1,3-thiazole-4-carbonyl]amino]phenyl]ethynyl]benzoate.
| Compound Name | methyl 3-[2-[3-[[2-(1-methylpyrazol-4-yl)-1,3-thiazole-4-carbonyl]amino]phenyl]ethynyl]benzoate |
|---|---|
| PubChem CID | 55788748 |
| Molecular Formula | C24H18N4O3S |
| Molecular Weight | 442.50 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | methyl 3-[2-[3-[[2-(1-methylpyrazol-4-yl)-1,3-thiazole-4-carbonyl]amino]phenyl]ethynyl]benzoate |
| SMILES | COC(=O)c1cccc(C#Cc2cccc(NC(=O)c3csc(-c4cnn(C)c4)n3)c2)c1 |
| InChI | InChI=1S/C24H18N4O3S/c1-28-14-19(13-25-28)23-27-21(15-32-23)22(29)26-20-8-4-6-17(12-20)10-9-16-5-3-7-18(11-16)24(30)31-2/h3-8,11-15H,1-2H3,(H,26,29) |
| InChIKey | ROSMJBSYJLASPS-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.50 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|