C25H33N3O5S — CID 55791663
benzyl N-[1-[4-(azepan-1-yl)anilino]-4-methylsulfonyl-1-oxobutan-2-yl]carbamate (PubChem CID 55791663) has the molecular formula C25H33N3O5S and a molecular weight of 487.62 g/mol. Its IUPAC name is benzyl N-[1-[4-(azepan-1-yl)anilino]-4-methylsulfonyl-1-oxobutan-2-yl]carbamate.
| Compound Name | benzyl N-[1-[4-(azepan-1-yl)anilino]-4-methylsulfonyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 55791663 |
| Molecular Formula | C25H33N3O5S |
| Molecular Weight | 487.62 g/mol |
| Exact Mass | 487.21 |
| IUPAC Name | benzyl N-[1-[4-(azepan-1-yl)anilino]-4-methylsulfonyl-1-oxobutan-2-yl]carbamate |
| SMILES | CS(=O)(=O)CCC(NC(=O)OCc1ccccc1)C(=O)Nc1ccc(N2CCCCCC2)cc1 |
| InChI | InChI=1S/C25H33N3O5S/c1-34(31,32)18-15-23(27-25(30)33-19-20-9-5-4-6-10-20)24(29)26-21-11-13-22(14-12-21)28-16-7-2-3-8-17-28/h4-6,9-14,23H,2-3,7-8,15-19H2,1H3,(H,26,29)(H,27,30) |
| InChIKey | WVWAWMLARDNXBU-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.62 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|