C25H32N2O5S — CID 55700199
benzyl N-[4-methylsulfonyl-1-oxo-1-[(1-phenylcyclopentyl)methylamino]butan-2-yl]carbamate (PubChem CID 55700199) has the molecular formula C25H32N2O5S and a molecular weight of 472.61 g/mol. Its IUPAC name is benzyl N-[4-methylsulfonyl-1-oxo-1-[(1-phenylcyclopentyl)methylamino]butan-2-yl]carbamate.
| Compound Name | benzyl N-[4-methylsulfonyl-1-oxo-1-[(1-phenylcyclopentyl)methylamino]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 55700199 |
| Molecular Formula | C25H32N2O5S |
| Molecular Weight | 472.61 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | benzyl N-[4-methylsulfonyl-1-oxo-1-[(1-phenylcyclopentyl)methylamino]butan-2-yl]carbamate |
| SMILES | CS(=O)(=O)CCC(NC(=O)OCc1ccccc1)C(=O)NCC1(c2ccccc2)CCCC1 |
| InChI | InChI=1S/C25H32N2O5S/c1-33(30,31)17-14-22(27-24(29)32-18-20-10-4-2-5-11-20)23(28)26-19-25(15-8-9-16-25)21-12-6-3-7-13-21/h2-7,10-13,22H,8-9,14-19H2,1H3,(H,26,28)(H,27,29) |
| InChIKey | IKKKLMOQTIREEG-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.61 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |