C24H32N2O5S — CID 55850207
benzyl N-[1-[(3-methyl-2-phenylbutyl)amino]-4-methylsulfonyl-1-oxobutan-2-yl]carbamate (PubChem CID 55850207) has the molecular formula C24H32N2O5S and a molecular weight of 460.60 g/mol. Its IUPAC name is benzyl N-[1-[(3-methyl-2-phenylbutyl)amino]-4-methylsulfonyl-1-oxobutan-2-yl]carbamate.
| Compound Name | benzyl N-[1-[(3-methyl-2-phenylbutyl)amino]-4-methylsulfonyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 55850207 |
| Molecular Formula | C24H32N2O5S |
| Molecular Weight | 460.60 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | benzyl N-[1-[(3-methyl-2-phenylbutyl)amino]-4-methylsulfonyl-1-oxobutan-2-yl]carbamate |
| SMILES | CC(C)C(CNC(=O)C(CCS(C)(=O)=O)NC(=O)OCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H32N2O5S/c1-18(2)21(20-12-8-5-9-13-20)16-25-23(27)22(14-15-32(3,29)30)26-24(28)31-17-19-10-6-4-7-11-19/h4-13,18,21-22H,14-17H2,1-3H3,(H,25,27)(H,26,28) |
| InChIKey | PVYKNZSNOGCDFE-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.60 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |