C23H29N3O7S — CID 55913891
benzyl N-[1-[2-[2-(3,4-dimethylphenoxy)acetyl]hydrazinyl]-4-methylsulfonyl-1-oxobutan-2-yl]carbamate (PubChem CID 55913891) has the molecular formula C23H29N3O7S and a molecular weight of 491.57 g/mol. Its IUPAC name is benzyl N-[1-[2-[2-(3,4-dimethylphenoxy)acetyl]hydrazinyl]-4-methylsulfonyl-1-oxobutan-2-yl]carbamate.
| Compound Name | benzyl N-[1-[2-[2-(3,4-dimethylphenoxy)acetyl]hydrazinyl]-4-methylsulfonyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 55913891 |
| Molecular Formula | C23H29N3O7S |
| Molecular Weight | 491.57 g/mol |
| Exact Mass | 491.17 |
| IUPAC Name | benzyl N-[1-[2-[2-(3,4-dimethylphenoxy)acetyl]hydrazinyl]-4-methylsulfonyl-1-oxobutan-2-yl]carbamate |
| SMILES | Cc1ccc(OCC(=O)NNC(=O)C(CCS(C)(=O)=O)NC(=O)OCc2ccccc2)cc1C |
| InChI | InChI=1S/C23H29N3O7S/c1-16-9-10-19(13-17(16)2)32-15-21(27)25-26-22(28)20(11-12-34(3,30)31)24-23(29)33-14-18-7-5-4-6-8-18/h4-10,13,20H,11-12,14-15H2,1-3H3,(H,24,29)(H,25,27)(H,26,28) |
| InChIKey | GRZAMIUGKJAPEN-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 139.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.57 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|