C23H31N5O4 — CID 55794671
1-[(3-methoxy-4-propan-2-yloxybenzoyl)amino]-3-[(6-piperidin-1-yl-3-pyridinyl)methyl]urea (PubChem CID 55794671) has the molecular formula C23H31N5O4 and a molecular weight of 441.53 g/mol. Its IUPAC name is 1-[(3-methoxy-4-propan-2-yloxybenzoyl)amino]-3-[(6-piperidin-1-yl-3-pyridinyl)methyl]urea.
| Compound Name | 1-[(3-methoxy-4-propan-2-yloxybenzoyl)amino]-3-[(6-piperidin-1-yl-3-pyridinyl)methyl]urea |
|---|---|
| PubChem CID | 55794671 |
| Molecular Formula | C23H31N5O4 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.24 |
| IUPAC Name | 1-[(3-methoxy-4-propan-2-yloxybenzoyl)amino]-3-[(6-piperidin-1-yl-3-pyridinyl)methyl]urea |
| SMILES | COc1cc(C(=O)NNC(=O)NCc2ccc(N3CCCCC3)nc2)ccc1OC(C)C |
| InChI | InChI=1S/C23H31N5O4/c1-16(2)32-19-9-8-18(13-20(19)31-3)22(29)26-27-23(30)25-15-17-7-10-21(24-14-17)28-11-5-4-6-12-28/h7-10,13-14,16H,4-6,11-12,15H2,1-3H3,(H,26,29)(H2,25,27,30) |
| InChIKey | FYOWOXBRJRRVJR-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 104.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|