C23H32N6O4 — CID 55794851
1-[(3-methoxy-4-propan-2-yloxybenzoyl)amino]-3-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]urea (PubChem CID 55794851) has the molecular formula C23H32N6O4 and a molecular weight of 456.55 g/mol. Its IUPAC name is 1-[(3-methoxy-4-propan-2-yloxybenzoyl)amino]-3-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]urea.
| Compound Name | 1-[(3-methoxy-4-propan-2-yloxybenzoyl)amino]-3-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]urea |
|---|---|
| PubChem CID | 55794851 |
| Molecular Formula | C23H32N6O4 |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 456.25 |
| IUPAC Name | 1-[(3-methoxy-4-propan-2-yloxybenzoyl)amino]-3-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]urea |
| SMILES | COc1cc(C(=O)NNC(=O)NCc2ccnc(N3CCN(C)CC3)c2)ccc1OC(C)C |
| InChI | InChI=1S/C23H32N6O4/c1-16(2)33-19-6-5-18(14-20(19)32-4)22(30)26-27-23(31)25-15-17-7-8-24-21(13-17)29-11-9-28(3)10-12-29/h5-8,13-14,16H,9-12,15H2,1-4H3,(H,26,30)(H2,25,27,31) |
| InChIKey | OQOWTKKGBUGSQT-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 108.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|