C25H26N6O4 — CID 154805885
1-[[6-(benzimidazol-1-yl)-3-pyridinyl]methyl]-3-[(3-methoxy-4-propan-2-yloxybenzoyl)amino]urea (PubChem CID 154805885) has the molecular formula C25H26N6O4 and a molecular weight of 474.52 g/mol. Its IUPAC name is 1-[[6-(benzimidazol-1-yl)-3-pyridinyl]methyl]-3-[(3-methoxy-4-propan-2-yloxybenzoyl)amino]urea.
| Compound Name | 1-[[6-(benzimidazol-1-yl)-3-pyridinyl]methyl]-3-[(3-methoxy-4-propan-2-yloxybenzoyl)amino]urea |
|---|---|
| PubChem CID | 154805885 |
| Molecular Formula | C25H26N6O4 |
| Molecular Weight | 474.52 g/mol |
| Exact Mass | 474.20 |
| IUPAC Name | 1-[[6-(benzimidazol-1-yl)-3-pyridinyl]methyl]-3-[(3-methoxy-4-propan-2-yloxybenzoyl)amino]urea |
| SMILES | COc1cc(C(=O)NNC(=O)NCc2ccc(-n3cnc4ccccc43)nc2)ccc1OC(C)C |
| InChI | InChI=1S/C25H26N6O4/c1-16(2)35-21-10-9-18(12-22(21)34-3)24(32)29-30-25(33)27-14-17-8-11-23(26-13-17)31-15-28-19-6-4-5-7-20(19)31/h4-13,15-16H,14H2,1-3H3,(H,29,32)(H2,27,30,33) |
| InChIKey | OZHJNTODKRYZHR-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 119.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.52 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|