C22H28N4O4 — CID 55742869
2-(4-acetyl-2-methoxyphenoxy)-N-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]acetamide (PubChem CID 55742869) has the molecular formula C22H28N4O4 and a molecular weight of 412.49 g/mol. Its IUPAC name is 2-(4-acetyl-2-methoxyphenoxy)-N-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]acetamide.
| Compound Name | 2-(4-acetyl-2-methoxyphenoxy)-N-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]acetamide |
|---|---|
| PubChem CID | 55742869 |
| Molecular Formula | C22H28N4O4 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | 2-(4-acetyl-2-methoxyphenoxy)-N-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]acetamide |
| SMILES | COc1cc(C(C)=O)ccc1OCC(=O)NCc1ccnc(N2CCN(C)CC2)c1 |
| InChI | InChI=1S/C22H28N4O4/c1-16(27)18-4-5-19(20(13-18)29-3)30-15-22(28)24-14-17-6-7-23-21(12-17)26-10-8-25(2)9-11-26/h4-7,12-13H,8-11,14-15H2,1-3H3,(H,24,28) |
| InChIKey | HCYGRSAHKKARGE-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 84.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |