C24H33N5O3 — CID 55794733
N-[[6-(2,6-dimethylmorpholin-4-yl)-3-pyridinyl]methyl]-4-(4-methoxyphenyl)piperazine-1-carboxamide (PubChem CID 55794733) has the molecular formula C24H33N5O3 and a molecular weight of 439.56 g/mol. Its IUPAC name is N-[[6-(2,6-dimethylmorpholin-4-yl)-3-pyridinyl]methyl]-4-(4-methoxyphenyl)piperazine-1-carboxamide.
| Compound Name | N-[[6-(2,6-dimethylmorpholin-4-yl)-3-pyridinyl]methyl]-4-(4-methoxyphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 55794733 |
| Molecular Formula | C24H33N5O3 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.26 |
| IUPAC Name | N-[[6-(2,6-dimethylmorpholin-4-yl)-3-pyridinyl]methyl]-4-(4-methoxyphenyl)piperazine-1-carboxamide |
| SMILES | COc1ccc(N2CCN(C(=O)NCc3ccc(N4CC(C)OC(C)C4)nc3)CC2)cc1 |
| InChI | InChI=1S/C24H33N5O3/c1-18-16-29(17-19(2)32-18)23-9-4-20(14-25-23)15-26-24(30)28-12-10-27(11-13-28)21-5-7-22(31-3)8-6-21/h4-9,14,18-19H,10-13,15-17H2,1-3H3,(H,26,30) |
| InChIKey | LVLIBQLMNDXEBR-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 70.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|