C22H28ClN3O3 — CID 55797087
4-(4-chloro-2-methylphenoxy)-N-[[3-[[2-(dimethylamino)acetyl]amino]phenyl]methyl]butanamide (PubChem CID 55797087) has the molecular formula C22H28ClN3O3 and a molecular weight of 417.94 g/mol. Its IUPAC name is 4-(4-chloro-2-methylphenoxy)-N-[[3-[[2-(dimethylamino)acetyl]amino]phenyl]methyl]butanamide.
| Compound Name | 4-(4-chloro-2-methylphenoxy)-N-[[3-[[2-(dimethylamino)acetyl]amino]phenyl]methyl]butanamide |
|---|---|
| PubChem CID | 55797087 |
| Molecular Formula | C22H28ClN3O3 |
| Molecular Weight | 417.94 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | 4-(4-chloro-2-methylphenoxy)-N-[[3-[[2-(dimethylamino)acetyl]amino]phenyl]methyl]butanamide |
| SMILES | Cc1cc(Cl)ccc1OCCCC(=O)NCc1cccc(NC(=O)CN(C)C)c1 |
| InChI | InChI=1S/C22H28ClN3O3/c1-16-12-18(23)9-10-20(16)29-11-5-8-21(27)24-14-17-6-4-7-19(13-17)25-22(28)15-26(2)3/h4,6-7,9-10,12-13H,5,8,11,14-15H2,1-3H3,(H,24,27)(H,25,28) |
| InChIKey | BEMARAMLRCRTON-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.94 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|