C23H27ClN2O2 — CID 55799431
1-(4-tert-butylphenyl)-N-[2-chloro-5-(propanoylamino)phenyl]cyclopropane-1-carboxamide (PubChem CID 55799431) has the molecular formula C23H27ClN2O2 and a molecular weight of 398.93 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)-N-[2-chloro-5-(propanoylamino)phenyl]cyclopropane-1-carboxamide.
| Compound Name | 1-(4-tert-butylphenyl)-N-[2-chloro-5-(propanoylamino)phenyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 55799431 |
| Molecular Formula | C23H27ClN2O2 |
| Molecular Weight | 398.93 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | 1-(4-tert-butylphenyl)-N-[2-chloro-5-(propanoylamino)phenyl]cyclopropane-1-carboxamide |
| SMILES | CCC(=O)Nc1ccc(Cl)c(NC(=O)C2(c3ccc(C(C)(C)C)cc3)CC2)c1 |
| InChI | InChI=1S/C23H27ClN2O2/c1-5-20(27)25-17-10-11-18(24)19(14-17)26-21(28)23(12-13-23)16-8-6-15(7-9-16)22(2,3)4/h6-11,14H,5,12-13H2,1-4H3,(H,25,27)(H,26,28) |
| InChIKey | SRFLRUBTMROBQX-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.93 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |