C23H25ClN4O3 — CID 55805611
1-(4-chlorophenyl)-N-[2-(cyclohexanecarbonylamino)ethyl]-5-(furan-2-yl)pyrazole-3-carboxamide (PubChem CID 55805611) has the molecular formula C23H25ClN4O3 and a molecular weight of 440.93 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-[2-(cyclohexanecarbonylamino)ethyl]-5-(furan-2-yl)pyrazole-3-carboxamide.
| Compound Name | 1-(4-chlorophenyl)-N-[2-(cyclohexanecarbonylamino)ethyl]-5-(furan-2-yl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 55805611 |
| Molecular Formula | C23H25ClN4O3 |
| Molecular Weight | 440.93 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | 1-(4-chlorophenyl)-N-[2-(cyclohexanecarbonylamino)ethyl]-5-(furan-2-yl)pyrazole-3-carboxamide |
| SMILES | O=C(NCCNC(=O)C1CCCCC1)c1cc(-c2ccco2)n(-c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C23H25ClN4O3/c24-17-8-10-18(11-9-17)28-20(21-7-4-14-31-21)15-19(27-28)23(30)26-13-12-25-22(29)16-5-2-1-3-6-16/h4,7-11,14-16H,1-3,5-6,12-13H2,(H,25,29)(H,26,30) |
| InChIKey | LQQXQOKWHQUJQT-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 89.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.93 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|