C28H29N3O3 — CID 55806762
N-[3-(2-ethoxyethoxymethyl)phenyl]-3-(2-methylphenyl)-1-phenylpyrazole-4-carboxamide (PubChem CID 55806762) has the molecular formula C28H29N3O3 and a molecular weight of 455.56 g/mol. Its IUPAC name is N-[3-(2-ethoxyethoxymethyl)phenyl]-3-(2-methylphenyl)-1-phenylpyrazole-4-carboxamide.
| Compound Name | N-[3-(2-ethoxyethoxymethyl)phenyl]-3-(2-methylphenyl)-1-phenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 55806762 |
| Molecular Formula | C28H29N3O3 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.22 |
| IUPAC Name | N-[3-(2-ethoxyethoxymethyl)phenyl]-3-(2-methylphenyl)-1-phenylpyrazole-4-carboxamide |
| SMILES | CCOCCOCc1cccc(NC(=O)c2cn(-c3ccccc3)nc2-c2ccccc2C)c1 |
| InChI | InChI=1S/C28H29N3O3/c1-3-33-16-17-34-20-22-11-9-12-23(18-22)29-28(32)26-19-31(24-13-5-4-6-14-24)30-27(26)25-15-8-7-10-21(25)2/h4-15,18-19H,3,16-17,20H2,1-2H3,(H,29,32) |
| InChIKey | SCTAFJVMHFMCIC-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|