C19H29FN2O3 — CID 55808705
1-[2-(4-fluorophenoxy)ethyl]-1-methyl-3-[2-(2-methylcyclohexyl)oxyethyl]urea (PubChem CID 55808705) has the molecular formula C19H29FN2O3 and a molecular weight of 352.45 g/mol. Its IUPAC name is 1-[2-(4-fluorophenoxy)ethyl]-1-methyl-3-[2-(2-methylcyclohexyl)oxyethyl]urea.
| Compound Name | 1-[2-(4-fluorophenoxy)ethyl]-1-methyl-3-[2-(2-methylcyclohexyl)oxyethyl]urea |
|---|---|
| PubChem CID | 55808705 |
| Molecular Formula | C19H29FN2O3 |
| Molecular Weight | 352.45 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | 1-[2-(4-fluorophenoxy)ethyl]-1-methyl-3-[2-(2-methylcyclohexyl)oxyethyl]urea |
| SMILES | CC1CCCCC1OCCNC(=O)N(C)CCOc1ccc(F)cc1 |
| InChI | InChI=1S/C19H29FN2O3/c1-15-5-3-4-6-18(15)25-13-11-21-19(23)22(2)12-14-24-17-9-7-16(20)8-10-17/h7-10,15,18H,3-6,11-14H2,1-2H3,(H,21,23) |
| InChIKey | PAAZLZYZEKCFES-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.45 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|