C19H23N7O2 — CID 55809666
1-[3-(2-oxoimidazolidin-1-yl)phenyl]-3-(1-pyrimidin-2-ylpiperidin-3-yl)urea (PubChem CID 55809666) has the molecular formula C19H23N7O2 and a molecular weight of 381.44 g/mol. Its IUPAC name is 1-[3-(2-oxoimidazolidin-1-yl)phenyl]-3-(1-pyrimidin-2-ylpiperidin-3-yl)urea.
| Compound Name | 1-[3-(2-oxoimidazolidin-1-yl)phenyl]-3-(1-pyrimidin-2-ylpiperidin-3-yl)urea |
|---|---|
| PubChem CID | 55809666 |
| Molecular Formula | C19H23N7O2 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | 1-[3-(2-oxoimidazolidin-1-yl)phenyl]-3-(1-pyrimidin-2-ylpiperidin-3-yl)urea |
| SMILES | O=C(Nc1cccc(N2CCNC2=O)c1)NC1CCCN(c2ncccn2)C1 |
| InChI | InChI=1S/C19H23N7O2/c27-18(23-14-4-1-6-16(12-14)26-11-9-22-19(26)28)24-15-5-2-10-25(13-15)17-20-7-3-8-21-17/h1,3-4,6-8,12,15H,2,5,9-11,13H2,(H,22,28)(H2,23,24,27) |
| InChIKey | AFCZGRFELUGXQE-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 102.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |