C18H21N9O — CID 125161705
1-[4-(5-methyltetrazol-1-yl)phenyl]-3-[(3R)-1-pyrimidin-2-ylpiperidin-3-yl]urea (PubChem CID 125161705) has the molecular formula C18H21N9O and a molecular weight of 379.43 g/mol. Its IUPAC name is 1-[4-(5-methyltetrazol-1-yl)phenyl]-3-[(3R)-1-pyrimidin-2-ylpiperidin-3-yl]urea.
| Compound Name | 1-[4-(5-methyltetrazol-1-yl)phenyl]-3-[(3R)-1-pyrimidin-2-ylpiperidin-3-yl]urea |
|---|---|
| PubChem CID | 125161705 |
| Molecular Formula | C18H21N9O |
| Molecular Weight | 379.43 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | 1-[4-(5-methyltetrazol-1-yl)phenyl]-3-[(3R)-1-pyrimidin-2-ylpiperidin-3-yl]urea |
| SMILES | Cc1nnnn1-c1ccc(NC(=O)N[C@@H]2CCCN(c3ncccn3)C2)cc1 |
| InChI | InChI=1S/C18H21N9O/c1-13-23-24-25-27(13)16-7-5-14(6-8-16)21-18(28)22-15-4-2-11-26(12-15)17-19-9-3-10-20-17/h3,5-10,15H,2,4,11-12H2,1H3,(H2,21,22,28)/t15-/m1/s1 |
| InChIKey | XQXRMAYADYXONV-OAHLLOKOSA-N |
| XLogP | 1.55 |
| TPSA | 113.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.43 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |