C24H29ClN4O3S — CID 55814051
4-chloro-3-(diethylsulfamoyl)-N-methyl-N-[3-(3-phenyl-1H-pyrazol-5-yl)propyl]benzamide (PubChem CID 55814051) has the molecular formula C24H29ClN4O3S and a molecular weight of 489.04 g/mol. Its IUPAC name is 4-chloro-3-(diethylsulfamoyl)-N-methyl-N-[3-(3-phenyl-1H-pyrazol-5-yl)propyl]benzamide.
| Compound Name | 4-chloro-3-(diethylsulfamoyl)-N-methyl-N-[3-(3-phenyl-1H-pyrazol-5-yl)propyl]benzamide |
|---|---|
| PubChem CID | 55814051 |
| Molecular Formula | C24H29ClN4O3S |
| Molecular Weight | 489.04 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | 4-chloro-3-(diethylsulfamoyl)-N-methyl-N-[3-(3-phenyl-1H-pyrazol-5-yl)propyl]benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(C(=O)N(C)CCCc2cc(-c3ccccc3)n[nH]2)ccc1Cl |
| InChI | InChI=1S/C24H29ClN4O3S/c1-4-29(5-2)33(31,32)23-16-19(13-14-21(23)25)24(30)28(3)15-9-12-20-17-22(27-26-20)18-10-7-6-8-11-18/h6-8,10-11,13-14,16-17H,4-5,9,12,15H2,1-3H3,(H,26,27) |
| InChIKey | DFAWBJGCXQCUSK-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 86.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.04 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |