C18H19BrClN3O3S — CID 55816205
1-(4-bromo-2-chlorophenyl)sulfonyl-N-(4-methyl-2-pyridinyl)piperidine-4-carboxamide (PubChem CID 55816205) has the molecular formula C18H19BrClN3O3S and a molecular weight of 472.79 g/mol. Its IUPAC name is 1-(4-bromo-2-chlorophenyl)sulfonyl-N-(4-methyl-2-pyridinyl)piperidine-4-carboxamide.
| Compound Name | 1-(4-bromo-2-chlorophenyl)sulfonyl-N-(4-methyl-2-pyridinyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55816205 |
| Molecular Formula | C18H19BrClN3O3S |
| Molecular Weight | 472.79 g/mol |
| Exact Mass | 471.00 |
| IUPAC Name | 1-(4-bromo-2-chlorophenyl)sulfonyl-N-(4-methyl-2-pyridinyl)piperidine-4-carboxamide |
| SMILES | Cc1ccnc(NC(=O)C2CCN(S(=O)(=O)c3ccc(Br)cc3Cl)CC2)c1 |
| InChI | InChI=1S/C18H19BrClN3O3S/c1-12-4-7-21-17(10-12)22-18(24)13-5-8-23(9-6-13)27(25,26)16-3-2-14(19)11-15(16)20/h2-4,7,10-11,13H,5-6,8-9H2,1H3,(H,21,22,24) |
| InChIKey | NAWYCDACJBVLCY-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.79 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |