C21H28N2O5 — CID 55819420
1-[(2,4-dimethoxyphenyl)methyl]-3-[3-(2-methoxyethoxymethyl)phenyl]-1-methylurea (PubChem CID 55819420) has the molecular formula C21H28N2O5 and a molecular weight of 388.46 g/mol. Its IUPAC name is 1-[(2,4-dimethoxyphenyl)methyl]-3-[3-(2-methoxyethoxymethyl)phenyl]-1-methylurea.
| Compound Name | 1-[(2,4-dimethoxyphenyl)methyl]-3-[3-(2-methoxyethoxymethyl)phenyl]-1-methylurea |
|---|---|
| PubChem CID | 55819420 |
| Molecular Formula | C21H28N2O5 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | 1-[(2,4-dimethoxyphenyl)methyl]-3-[3-(2-methoxyethoxymethyl)phenyl]-1-methylurea |
| SMILES | COCCOCc1cccc(NC(=O)N(C)Cc2ccc(OC)cc2OC)c1 |
| InChI | InChI=1S/C21H28N2O5/c1-23(14-17-8-9-19(26-3)13-20(17)27-4)21(24)22-18-7-5-6-16(12-18)15-28-11-10-25-2/h5-9,12-13H,10-11,14-15H2,1-4H3,(H,22,24) |
| InChIKey | WULBZQINNBOQIC-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|