C19H23N3O4S2 — CID 55819738
(E)-N-(4-ethoxy-3-piperidin-1-ylsulfonylphenyl)-3-(1,3-thiazol-2-yl)prop-2-enamide (PubChem CID 55819738) has the molecular formula C19H23N3O4S2 and a molecular weight of 421.54 g/mol. Its IUPAC name is (E)-N-(4-ethoxy-3-piperidin-1-ylsulfonylphenyl)-3-(1,3-thiazol-2-yl)prop-2-enamide.
| Compound Name | (E)-N-(4-ethoxy-3-piperidin-1-ylsulfonylphenyl)-3-(1,3-thiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 55819738 |
| Molecular Formula | C19H23N3O4S2 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | (E)-N-(4-ethoxy-3-piperidin-1-ylsulfonylphenyl)-3-(1,3-thiazol-2-yl)prop-2-enamide |
| SMILES | CCOc1ccc(NC(=O)/C=C/c2nccs2)cc1S(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C19H23N3O4S2/c1-2-26-16-7-6-15(21-18(23)8-9-19-20-10-13-27-19)14-17(16)28(24,25)22-11-4-3-5-12-22/h6-10,13-14H,2-5,11-12H2,1H3,(H,21,23)/b9-8+ |
| InChIKey | CCNIYBJCWOHRTH-CMDGGOBGSA-N |
| XLogP | 3.37 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|