C16H18BrN3O3 — CID 55823963
4-bromo-1-ethyl-N-[3-[(2-methoxyacetyl)amino]phenyl]pyrrole-2-carboxamide (PubChem CID 55823963) has the molecular formula C16H18BrN3O3 and a molecular weight of 380.24 g/mol. Its IUPAC name is 4-bromo-1-ethyl-N-[3-[(2-methoxyacetyl)amino]phenyl]pyrrole-2-carboxamide.
| Compound Name | 4-bromo-1-ethyl-N-[3-[(2-methoxyacetyl)amino]phenyl]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 55823963 |
| Molecular Formula | C16H18BrN3O3 |
| Molecular Weight | 380.24 g/mol |
| Exact Mass | 379.05 |
| IUPAC Name | 4-bromo-1-ethyl-N-[3-[(2-methoxyacetyl)amino]phenyl]pyrrole-2-carboxamide |
| SMILES | CCn1cc(Br)cc1C(=O)Nc1cccc(NC(=O)COC)c1 |
| InChI | InChI=1S/C16H18BrN3O3/c1-3-20-9-11(17)7-14(20)16(22)19-13-6-4-5-12(8-13)18-15(21)10-23-2/h4-9H,3,10H2,1-2H3,(H,18,21)(H,19,22) |
| InChIKey | IJULKEPDCDSZQO-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.24 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |