C14H13BrF2N2OS — CID 60955535
4-bromo-N-[4-(difluoromethylsulfanyl)phenyl]-1-ethylpyrrole-2-carboxamide (PubChem CID 60955535) has the molecular formula C14H13BrF2N2OS and a molecular weight of 375.24 g/mol. Its IUPAC name is 4-bromo-N-[4-(difluoromethylsulfanyl)phenyl]-1-ethylpyrrole-2-carboxamide.
| Compound Name | 4-bromo-N-[4-(difluoromethylsulfanyl)phenyl]-1-ethylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 60955535 |
| Molecular Formula | C14H13BrF2N2OS |
| Molecular Weight | 375.24 g/mol |
| Exact Mass | 373.99 |
| IUPAC Name | 4-bromo-N-[4-(difluoromethylsulfanyl)phenyl]-1-ethylpyrrole-2-carboxamide |
| SMILES | CCn1cc(Br)cc1C(=O)Nc1ccc(SC(F)F)cc1 |
| InChI | InChI=1S/C14H13BrF2N2OS/c1-2-19-8-9(15)7-12(19)13(20)18-10-3-5-11(6-4-10)21-14(16)17/h3-8,14H,2H2,1H3,(H,18,20) |
| InChIKey | LVBCOLRDEGTYJA-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.24 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |