C18H19NO7S — CID 55824099
methyl 2-[2-methoxy-5-[(4-methylphenyl)sulfonylcarbamoyl]phenoxy]acetate (PubChem CID 55824099) has the molecular formula C18H19NO7S and a molecular weight of 393.42 g/mol. Its IUPAC name is methyl 2-[2-methoxy-5-[(4-methylphenyl)sulfonylcarbamoyl]phenoxy]acetate.
| Compound Name | methyl 2-[2-methoxy-5-[(4-methylphenyl)sulfonylcarbamoyl]phenoxy]acetate |
|---|---|
| PubChem CID | 55824099 |
| Molecular Formula | C18H19NO7S |
| Molecular Weight | 393.42 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | methyl 2-[2-methoxy-5-[(4-methylphenyl)sulfonylcarbamoyl]phenoxy]acetate |
| SMILES | COC(=O)COc1cc(C(=O)NS(=O)(=O)c2ccc(C)cc2)ccc1OC |
| InChI | InChI=1S/C18H19NO7S/c1-12-4-7-14(8-5-12)27(22,23)19-18(21)13-6-9-15(24-2)16(10-13)26-11-17(20)25-3/h4-10H,11H2,1-3H3,(H,19,21) |
| InChIKey | LOAPQIITVICWRV-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.42 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |