C25H33FN6O2 — CID 55824177
1-[2-(4-fluorophenyl)acetyl]-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]piperidine-3-carboxamide (PubChem CID 55824177) has the molecular formula C25H33FN6O2 and a molecular weight of 468.58 g/mol. Its IUPAC name is 1-[2-(4-fluorophenyl)acetyl]-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]piperidine-3-carboxamide.
| Compound Name | 1-[2-(4-fluorophenyl)acetyl]-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 55824177 |
| Molecular Formula | C25H33FN6O2 |
| Molecular Weight | 468.58 g/mol |
| Exact Mass | 468.26 |
| IUPAC Name | 1-[2-(4-fluorophenyl)acetyl]-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]piperidine-3-carboxamide |
| SMILES | O=C(NCCCN1CCN(c2ncccn2)CC1)C1CCCN(C(=O)Cc2ccc(F)cc2)C1 |
| InChI | InChI=1S/C25H33FN6O2/c26-22-7-5-20(6-8-22)18-23(33)32-13-1-4-21(19-32)24(34)27-11-3-12-30-14-16-31(17-15-30)25-28-9-2-10-29-25/h2,5-10,21H,1,3-4,11-19H2,(H,27,34) |
| InChIKey | MHNKTILBLOKDDZ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.58 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|