C19H24BrN3O3S — CID 55826423
N-[1-(4-bromophenyl)cyclopropyl]-4-(diethylsulfamoyl)-1-methylpyrrole-2-carboxamide (PubChem CID 55826423) has the molecular formula C19H24BrN3O3S and a molecular weight of 454.39 g/mol. Its IUPAC name is N-[1-(4-bromophenyl)cyclopropyl]-4-(diethylsulfamoyl)-1-methylpyrrole-2-carboxamide.
| Compound Name | N-[1-(4-bromophenyl)cyclopropyl]-4-(diethylsulfamoyl)-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 55826423 |
| Molecular Formula | C19H24BrN3O3S |
| Molecular Weight | 454.39 g/mol |
| Exact Mass | 453.07 |
| IUPAC Name | N-[1-(4-bromophenyl)cyclopropyl]-4-(diethylsulfamoyl)-1-methylpyrrole-2-carboxamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(C(=O)NC2(c3ccc(Br)cc3)CC2)n(C)c1 |
| InChI | InChI=1S/C19H24BrN3O3S/c1-4-23(5-2)27(25,26)16-12-17(22(3)13-16)18(24)21-19(10-11-19)14-6-8-15(20)9-7-14/h6-9,12-13H,4-5,10-11H2,1-3H3,(H,21,24) |
| InChIKey | OKDNECVZLNGVER-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.39 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |