C18H22F2N2O2S — CID 55827331
4-[3-[4-(difluoromethylsulfonyl)anilino]propyl]-N,N-dimethylaniline (PubChem CID 55827331) has the molecular formula C18H22F2N2O2S and a molecular weight of 368.45 g/mol. Its IUPAC name is 4-[3-[4-(difluoromethylsulfonyl)anilino]propyl]-N,N-dimethylaniline.
| Compound Name | 4-[3-[4-(difluoromethylsulfonyl)anilino]propyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 55827331 |
| Molecular Formula | C18H22F2N2O2S |
| Molecular Weight | 368.45 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | 4-[3-[4-(difluoromethylsulfonyl)anilino]propyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(CCCNc2ccc(S(=O)(=O)C(F)F)cc2)cc1 |
| InChI | InChI=1S/C18H22F2N2O2S/c1-22(2)16-9-5-14(6-10-16)4-3-13-21-15-7-11-17(12-8-15)25(23,24)18(19)20/h5-12,18,21H,3-4,13H2,1-2H3 |
| InChIKey | KXMWEXJQGFPLRX-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.45 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|