C18H16F2N4O3 — CID 55828507
1-(2,5-difluorophenyl)-N-methyl-N-[[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]methyl]ethanamine (PubChem CID 55828507) has the molecular formula C18H16F2N4O3 and a molecular weight of 374.35 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)-N-methyl-N-[[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]methyl]ethanamine.
| Compound Name | 1-(2,5-difluorophenyl)-N-methyl-N-[[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 55828507 |
| Molecular Formula | C18H16F2N4O3 |
| Molecular Weight | 374.35 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | 1-(2,5-difluorophenyl)-N-methyl-N-[[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]methyl]ethanamine |
| SMILES | CC(c1cc(F)ccc1F)N(C)Cc1nc(-c2cccc([N+](=O)[O-])c2)no1 |
| InChI | InChI=1S/C18H16F2N4O3/c1-11(15-9-13(19)6-7-16(15)20)23(2)10-17-21-18(22-27-17)12-4-3-5-14(8-12)24(25)26/h3-9,11H,10H2,1-2H3 |
| InChIKey | OEHXTUORRIMNJO-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 85.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.35 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|