C19H19N5O3 — CID 97089173
N-[[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-[(1R)-1-pyridin-2-ylethyl]cyclopropanamine (PubChem CID 97089173) has the molecular formula C19H19N5O3 and a molecular weight of 365.39 g/mol. Its IUPAC name is N-[[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-[(1R)-1-pyridin-2-ylethyl]cyclopropanamine.
| Compound Name | N-[[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-[(1R)-1-pyridin-2-ylethyl]cyclopropanamine |
|---|---|
| PubChem CID | 97089173 |
| Molecular Formula | C19H19N5O3 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | N-[[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-[(1R)-1-pyridin-2-ylethyl]cyclopropanamine |
| SMILES | C[C@H](c1ccccn1)N(Cc1nc(-c2cccc([N+](=O)[O-])c2)no1)C1CC1 |
| InChI | InChI=1S/C19H19N5O3/c1-13(17-7-2-3-10-20-17)23(15-8-9-15)12-18-21-19(22-27-18)14-5-4-6-16(11-14)24(25)26/h2-7,10-11,13,15H,8-9,12H2,1H3/t13-/m1/s1 |
| InChIKey | IVJAAVXJRVITIJ-CYBMUJFWSA-N |
| XLogP | 3.77 |
| TPSA | 98.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|