C21H19F3N4O3 — CID 60568288
N-[[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-[1-[3-(trifluoromethyl)phenyl]ethyl]cyclopropanamine (PubChem CID 60568288) has the molecular formula C21H19F3N4O3 and a molecular weight of 432.40 g/mol. Its IUPAC name is N-[[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-[1-[3-(trifluoromethyl)phenyl]ethyl]cyclopropanamine.
| Compound Name | N-[[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-[1-[3-(trifluoromethyl)phenyl]ethyl]cyclopropanamine |
|---|---|
| PubChem CID | 60568288 |
| Molecular Formula | C21H19F3N4O3 |
| Molecular Weight | 432.40 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | N-[[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-[1-[3-(trifluoromethyl)phenyl]ethyl]cyclopropanamine |
| SMILES | CC(c1cccc(C(F)(F)F)c1)N(Cc1nc(-c2ccc([N+](=O)[O-])cc2)no1)C1CC1 |
| InChI | InChI=1S/C21H19F3N4O3/c1-13(15-3-2-4-16(11-15)21(22,23)24)27(17-9-10-17)12-19-25-20(26-31-19)14-5-7-18(8-6-14)28(29)30/h2-8,11,13,17H,9-10,12H2,1H3 |
| InChIKey | QBQGUNVPNTVAFZ-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 85.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.40 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|