C23H22N4OS — CID 55828562
10-methyl-N-[[3-(pyridin-2-ylmethoxy)phenyl]methyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine (PubChem CID 55828562) has the molecular formula C23H22N4OS and a molecular weight of 402.52 g/mol. Its IUPAC name is 10-methyl-N-[[3-(pyridin-2-ylmethoxy)phenyl]methyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine.
| Compound Name | 10-methyl-N-[[3-(pyridin-2-ylmethoxy)phenyl]methyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine |
|---|---|
| PubChem CID | 55828562 |
| Molecular Formula | C23H22N4OS |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | 10-methyl-N-[[3-(pyridin-2-ylmethoxy)phenyl]methyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine |
| SMILES | Cc1nc(NCc2cccc(OCc3ccccn3)c2)c2c3c(sc2n1)CCC3 |
| InChI | InChI=1S/C23H22N4OS/c1-15-26-22(21-19-9-5-10-20(19)29-23(21)27-15)25-13-16-6-4-8-18(12-16)28-14-17-7-2-3-11-24-17/h2-4,6-8,11-12H,5,9-10,13-14H2,1H3,(H,25,26,27) |
| InChIKey | OCPAPAUUDQEBAU-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |