C22H28N4OS — CID 7987652
(1R)-1-(3-methoxyphenyl)-N,N-dimethyl-N'-(2-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)ethane-1,2-diamine (PubChem CID 7987652) has the molecular formula C22H28N4OS and a molecular weight of 396.56 g/mol. Its IUPAC name is (1R)-1-(3-methoxyphenyl)-N,N-dimethyl-N'-(2-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)ethane-1,2-diamine.
| Compound Name | (1R)-1-(3-methoxyphenyl)-N,N-dimethyl-N'-(2-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 7987652 |
| Molecular Formula | C22H28N4OS |
| Molecular Weight | 396.56 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | (1R)-1-(3-methoxyphenyl)-N,N-dimethyl-N'-(2-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)ethane-1,2-diamine |
| SMILES | COc1cccc([C@H](CNc2nc(C)nc3sc4c(c23)CCCC4)N(C)C)c1 |
| InChI | InChI=1S/C22H28N4OS/c1-14-24-21(20-17-10-5-6-11-19(17)28-22(20)25-14)23-13-18(26(2)3)15-8-7-9-16(12-15)27-4/h7-9,12,18H,5-6,10-11,13H2,1-4H3,(H,23,24,25)/t18-/m0/s1 |
| InChIKey | MQGBMOONTGTCQM-SFHVURJKSA-N |
| XLogP | 4.60 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.56 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |