C19H18F3N3OS — CID 97008522
(1S)-2-[(10-methyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)amino]-1-[2-(trifluoromethyl)phenyl]ethanol (PubChem CID 97008522) has the molecular formula C19H18F3N3OS and a molecular weight of 393.43 g/mol. Its IUPAC name is (1S)-2-[(10-methyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)amino]-1-[2-(trifluoromethyl)phenyl]ethanol.
| Compound Name | (1S)-2-[(10-methyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)amino]-1-[2-(trifluoromethyl)phenyl]ethanol |
|---|---|
| PubChem CID | 97008522 |
| Molecular Formula | C19H18F3N3OS |
| Molecular Weight | 393.43 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | (1S)-2-[(10-methyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)amino]-1-[2-(trifluoromethyl)phenyl]ethanol |
| SMILES | Cc1nc(NC[C@@H](O)c2ccccc2C(F)(F)F)c2c3c(sc2n1)CCC3 |
| InChI | InChI=1S/C19H18F3N3OS/c1-10-24-17(16-12-6-4-8-15(12)27-18(16)25-10)23-9-14(26)11-5-2-3-7-13(11)19(20,21)22/h2-3,5,7,14,26H,4,6,8-9H2,1H3,(H,23,24,25)/t14-/m1/s1 |
| InChIKey | IKHMAYQDGXZDDE-CQSZACIVSA-N |
| XLogP | 4.65 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.43 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |