C21H30N4O7S — CID 55829465
N-[2-(dimethylamino)ethyl]-4-[1-[4-(2-hydroxyethoxy)-3-methoxyphenyl]ethylamino]-3-nitrobenzenesulfonamide (PubChem CID 55829465) has the molecular formula C21H30N4O7S and a molecular weight of 482.56 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-4-[1-[4-(2-hydroxyethoxy)-3-methoxyphenyl]ethylamino]-3-nitrobenzenesulfonamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-4-[1-[4-(2-hydroxyethoxy)-3-methoxyphenyl]ethylamino]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 55829465 |
| Molecular Formula | C21H30N4O7S |
| Molecular Weight | 482.56 g/mol |
| Exact Mass | 482.18 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-4-[1-[4-(2-hydroxyethoxy)-3-methoxyphenyl]ethylamino]-3-nitrobenzenesulfonamide |
| SMILES | COc1cc(C(C)Nc2ccc(S(=O)(=O)NCCN(C)C)cc2[N+](=O)[O-])ccc1OCCO |
| InChI | InChI=1S/C21H30N4O7S/c1-15(16-5-8-20(32-12-11-26)21(13-16)31-4)23-18-7-6-17(14-19(18)25(27)28)33(29,30)22-9-10-24(2)3/h5-8,13-15,22-23,26H,9-12H2,1-4H3 |
| InChIKey | UHXMULKMJIZGSO-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 143.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.56 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|