C22H24ClN3O2 — CID 55831124
2-(3-chlorophenyl)-4-[[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]methyl]-1,3-oxazole (PubChem CID 55831124) has the molecular formula C22H24ClN3O2 and a molecular weight of 397.91 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-4-[[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]methyl]-1,3-oxazole.
| Compound Name | 2-(3-chlorophenyl)-4-[[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]methyl]-1,3-oxazole |
|---|---|
| PubChem CID | 55831124 |
| Molecular Formula | C22H24ClN3O2 |
| Molecular Weight | 397.91 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | 2-(3-chlorophenyl)-4-[[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]methyl]-1,3-oxazole |
| SMILES | COc1ccc(N2CCCN(Cc3coc(-c4cccc(Cl)c4)n3)CC2)cc1 |
| InChI | InChI=1S/C22H24ClN3O2/c1-27-21-8-6-20(7-9-21)26-11-3-10-25(12-13-26)15-19-16-28-22(24-19)17-4-2-5-18(23)14-17/h2,4-9,14,16H,3,10-13,15H2,1H3 |
| InChIKey | OQTFTWDMLMVGJZ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 41.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.91 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|