C23H26N4O4S2 — CID 55833448
1-[3-(benzenesulfonyl)propylsulfanyl]-4-(3-ethoxypropyl)-[1,2,4]triazolo[4,3-a]quinazolin-5-one (PubChem CID 55833448) has the molecular formula C23H26N4O4S2 and a molecular weight of 486.62 g/mol. Its IUPAC name is 1-[3-(benzenesulfonyl)propylsulfanyl]-4-(3-ethoxypropyl)-[1,2,4]triazolo[4,3-a]quinazolin-5-one.
| Compound Name | 1-[3-(benzenesulfonyl)propylsulfanyl]-4-(3-ethoxypropyl)-[1,2,4]triazolo[4,3-a]quinazolin-5-one |
|---|---|
| PubChem CID | 55833448 |
| Molecular Formula | C23H26N4O4S2 |
| Molecular Weight | 486.62 g/mol |
| Exact Mass | 486.14 |
| IUPAC Name | 1-[3-(benzenesulfonyl)propylsulfanyl]-4-(3-ethoxypropyl)-[1,2,4]triazolo[4,3-a]quinazolin-5-one |
| SMILES | CCOCCCn1c(=O)c2ccccc2n2c(SCCCS(=O)(=O)c3ccccc3)nnc12 |
| InChI | InChI=1S/C23H26N4O4S2/c1-2-31-15-8-14-26-21(28)19-12-6-7-13-20(19)27-22(26)24-25-23(27)32-16-9-17-33(29,30)18-10-4-3-5-11-18/h3-7,10-13H,2,8-9,14-17H2,1H3 |
| InChIKey | HGDFTXUFJIMIIU-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 95.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.62 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|