C24H28N4O2S — CID 60529696
4-(3-ethoxypropyl)-1-(4-phenylbutan-2-ylsulfanyl)-[1,2,4]triazolo[4,3-a]quinazolin-5-one (PubChem CID 60529696) has the molecular formula C24H28N4O2S and a molecular weight of 436.58 g/mol. Its IUPAC name is 4-(3-ethoxypropyl)-1-(4-phenylbutan-2-ylsulfanyl)-[1,2,4]triazolo[4,3-a]quinazolin-5-one.
| Compound Name | 4-(3-ethoxypropyl)-1-(4-phenylbutan-2-ylsulfanyl)-[1,2,4]triazolo[4,3-a]quinazolin-5-one |
|---|---|
| PubChem CID | 60529696 |
| Molecular Formula | C24H28N4O2S |
| Molecular Weight | 436.58 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | 4-(3-ethoxypropyl)-1-(4-phenylbutan-2-ylsulfanyl)-[1,2,4]triazolo[4,3-a]quinazolin-5-one |
| SMILES | CCOCCCn1c(=O)c2ccccc2n2c(SC(C)CCc3ccccc3)nnc12 |
| InChI | InChI=1S/C24H28N4O2S/c1-3-30-17-9-16-27-22(29)20-12-7-8-13-21(20)28-23(27)25-26-24(28)31-18(2)14-15-19-10-5-4-6-11-19/h4-8,10-13,18H,3,9,14-17H2,1-2H3 |
| InChIKey | CSVSPTFASKZABA-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.58 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|