C25H24ClN5O2S — CID 39808421
1-[(3-chloro-4-methylquinolin-2-yl)methylsulfanyl]-4-(3-ethoxypropyl)-[1,2,4]triazolo[4,3-a]quinazolin-5-one (PubChem CID 39808421) has the molecular formula C25H24ClN5O2S and a molecular weight of 494.02 g/mol. Its IUPAC name is 1-[(3-chloro-4-methylquinolin-2-yl)methylsulfanyl]-4-(3-ethoxypropyl)-[1,2,4]triazolo[4,3-a]quinazolin-5-one.
| Compound Name | 1-[(3-chloro-4-methylquinolin-2-yl)methylsulfanyl]-4-(3-ethoxypropyl)-[1,2,4]triazolo[4,3-a]quinazolin-5-one |
|---|---|
| PubChem CID | 39808421 |
| Molecular Formula | C25H24ClN5O2S |
| Molecular Weight | 494.02 g/mol |
| Exact Mass | 493.13 |
| IUPAC Name | 1-[(3-chloro-4-methylquinolin-2-yl)methylsulfanyl]-4-(3-ethoxypropyl)-[1,2,4]triazolo[4,3-a]quinazolin-5-one |
| SMILES | CCOCCCn1c(=O)c2ccccc2n2c(SCc3nc4ccccc4c(C)c3Cl)nnc12 |
| InChI | InChI=1S/C25H24ClN5O2S/c1-3-33-14-8-13-30-23(32)18-10-5-7-12-21(18)31-24(30)28-29-25(31)34-15-20-22(26)16(2)17-9-4-6-11-19(17)27-20/h4-7,9-12H,3,8,13-15H2,1-2H3 |
| InChIKey | YGTSPHYHUFUXDX-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 74.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.02 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|