C21H16BrN3O3S — CID 55837910
5-bromo-N-[2-[3-[(3-cyanophenyl)methoxy]anilino]-2-oxoethyl]thiophene-2-carboxamide (PubChem CID 55837910) has the molecular formula C21H16BrN3O3S and a molecular weight of 470.35 g/mol. Its IUPAC name is 5-bromo-N-[2-[3-[(3-cyanophenyl)methoxy]anilino]-2-oxoethyl]thiophene-2-carboxamide.
| Compound Name | 5-bromo-N-[2-[3-[(3-cyanophenyl)methoxy]anilino]-2-oxoethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 55837910 |
| Molecular Formula | C21H16BrN3O3S |
| Molecular Weight | 470.35 g/mol |
| Exact Mass | 469.01 |
| IUPAC Name | 5-bromo-N-[2-[3-[(3-cyanophenyl)methoxy]anilino]-2-oxoethyl]thiophene-2-carboxamide |
| SMILES | N#Cc1cccc(COc2cccc(NC(=O)CNC(=O)c3ccc(Br)s3)c2)c1 |
| InChI | InChI=1S/C21H16BrN3O3S/c22-19-8-7-18(29-19)21(27)24-12-20(26)25-16-5-2-6-17(10-16)28-13-15-4-1-3-14(9-15)11-23/h1-10H,12-13H2,(H,24,27)(H,25,26) |
| InChIKey | REPOSLGYFWZXCU-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.35 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |