C19H19ClF4N2O — CID 55838949
N-[4-chloro-2-(trifluoromethyl)phenyl]-2-[ethyl-[1-(4-fluorophenyl)ethyl]amino]acetamide (PubChem CID 55838949) has the molecular formula C19H19ClF4N2O and a molecular weight of 402.82 g/mol. Its IUPAC name is N-[4-chloro-2-(trifluoromethyl)phenyl]-2-[ethyl-[1-(4-fluorophenyl)ethyl]amino]acetamide.
| Compound Name | N-[4-chloro-2-(trifluoromethyl)phenyl]-2-[ethyl-[1-(4-fluorophenyl)ethyl]amino]acetamide |
|---|---|
| PubChem CID | 55838949 |
| Molecular Formula | C19H19ClF4N2O |
| Molecular Weight | 402.82 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | N-[4-chloro-2-(trifluoromethyl)phenyl]-2-[ethyl-[1-(4-fluorophenyl)ethyl]amino]acetamide |
| SMILES | CCN(CC(=O)Nc1ccc(Cl)cc1C(F)(F)F)C(C)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H19ClF4N2O/c1-3-26(12(2)13-4-7-15(21)8-5-13)11-18(27)25-17-9-6-14(20)10-16(17)19(22,23)24/h4-10,12H,3,11H2,1-2H3,(H,25,27) |
| InChIKey | QVSSBHKOVNFGLX-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.82 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |