C24H20F3N5O2 — CID 55840563
2-[3,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrazol-4-yl]-2-oxo-N-[[4-(1H-pyrazol-5-yl)phenyl]methyl]acetamide (PubChem CID 55840563) has the molecular formula C24H20F3N5O2 and a molecular weight of 467.45 g/mol. Its IUPAC name is 2-[3,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrazol-4-yl]-2-oxo-N-[[4-(1H-pyrazol-5-yl)phenyl]methyl]acetamide.
| Compound Name | 2-[3,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrazol-4-yl]-2-oxo-N-[[4-(1H-pyrazol-5-yl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 55840563 |
| Molecular Formula | C24H20F3N5O2 |
| Molecular Weight | 467.45 g/mol |
| Exact Mass | 467.16 |
| IUPAC Name | 2-[3,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrazol-4-yl]-2-oxo-N-[[4-(1H-pyrazol-5-yl)phenyl]methyl]acetamide |
| SMILES | Cc1nn(-c2cccc(C(F)(F)F)c2)c(C)c1C(=O)C(=O)NCc1ccc(-c2ccn[nH]2)cc1 |
| InChI | InChI=1S/C24H20F3N5O2/c1-14-21(15(2)32(31-14)19-5-3-4-18(12-19)24(25,26)27)22(33)23(34)28-13-16-6-8-17(9-7-16)20-10-11-29-30-20/h3-12H,13H2,1-2H3,(H,28,34)(H,29,30) |
| InChIKey | XARJPLIJHWWJHG-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.45 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|