C15H20IN3O4S — CID 55841424
2-iodo-N-[2-[3-(methanesulfonamido)piperidin-1-yl]-2-oxoethyl]benzamide (PubChem CID 55841424) has the molecular formula C15H20IN3O4S and a molecular weight of 465.31 g/mol. Its IUPAC name is 2-iodo-N-[2-[3-(methanesulfonamido)piperidin-1-yl]-2-oxoethyl]benzamide.
| Compound Name | 2-iodo-N-[2-[3-(methanesulfonamido)piperidin-1-yl]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 55841424 |
| Molecular Formula | C15H20IN3O4S |
| Molecular Weight | 465.31 g/mol |
| Exact Mass | 465.02 |
| IUPAC Name | 2-iodo-N-[2-[3-(methanesulfonamido)piperidin-1-yl]-2-oxoethyl]benzamide |
| SMILES | CS(=O)(=O)NC1CCCN(C(=O)CNC(=O)c2ccccc2I)C1 |
| InChI | InChI=1S/C15H20IN3O4S/c1-24(22,23)18-11-5-4-8-19(10-11)14(20)9-17-15(21)12-6-2-3-7-13(12)16/h2-3,6-7,11,18H,4-5,8-10H2,1H3,(H,17,21) |
| InChIKey | ZIZGWTDMLCQKBL-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.31 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|