C20H34N4O3 — CID 55842925
tert-butyl N-[1-[2-[(1-cyanocyclohexyl)-methylamino]-2-oxoethyl]piperidin-4-yl]carbamate (PubChem CID 55842925) has the molecular formula C20H34N4O3 and a molecular weight of 378.52 g/mol. Its IUPAC name is tert-butyl N-[1-[2-[(1-cyanocyclohexyl)-methylamino]-2-oxoethyl]piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[2-[(1-cyanocyclohexyl)-methylamino]-2-oxoethyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 55842925 |
| Molecular Formula | C20H34N4O3 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.26 |
| IUPAC Name | tert-butyl N-[1-[2-[(1-cyanocyclohexyl)-methylamino]-2-oxoethyl]piperidin-4-yl]carbamate |
| SMILES | CN(C(=O)CN1CCC(NC(=O)OC(C)(C)C)CC1)C1(C#N)CCCCC1 |
| InChI | InChI=1S/C20H34N4O3/c1-19(2,3)27-18(26)22-16-8-12-24(13-9-16)14-17(25)23(4)20(15-21)10-6-5-7-11-20/h16H,5-14H2,1-4H3,(H,22,26) |
| InChIKey | DONUUZXRMGZZHV-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 85.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |