C24H25ClN6O4 — CID 55843039
N-[1-[2-(4-chloro-3-nitroanilino)-2-oxo-1-phenylethyl]piperidin-4-yl]-1-methylpyrazole-4-carboxamide (PubChem CID 55843039) has the molecular formula C24H25ClN6O4 and a molecular weight of 496.96 g/mol. Its IUPAC name is N-[1-[2-(4-chloro-3-nitroanilino)-2-oxo-1-phenylethyl]piperidin-4-yl]-1-methylpyrazole-4-carboxamide.
| Compound Name | N-[1-[2-(4-chloro-3-nitroanilino)-2-oxo-1-phenylethyl]piperidin-4-yl]-1-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 55843039 |
| Molecular Formula | C24H25ClN6O4 |
| Molecular Weight | 496.96 g/mol |
| Exact Mass | 496.16 |
| IUPAC Name | N-[1-[2-(4-chloro-3-nitroanilino)-2-oxo-1-phenylethyl]piperidin-4-yl]-1-methylpyrazole-4-carboxamide |
| SMILES | Cn1cc(C(=O)NC2CCN(C(C(=O)Nc3ccc(Cl)c([N+](=O)[O-])c3)c3ccccc3)CC2)cn1 |
| InChI | InChI=1S/C24H25ClN6O4/c1-29-15-17(14-26-29)23(32)27-18-9-11-30(12-10-18)22(16-5-3-2-4-6-16)24(33)28-19-7-8-20(25)21(13-19)31(34)35/h2-8,13-15,18,22H,9-12H2,1H3,(H,27,32)(H,28,33) |
| InChIKey | MCLNGGHRKVZYIR-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 122.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.96 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|