C22H25ClN4O4 — CID 124866133
(2S)-N-(4-chloro-3-nitrophenyl)-2-[(3S,4R)-3-hydroxy-4-pyrrolidin-1-ylpyrrolidin-1-yl]-2-phenylacetamide (PubChem CID 124866133) has the molecular formula C22H25ClN4O4 and a molecular weight of 444.92 g/mol. Its IUPAC name is (2S)-N-(4-chloro-3-nitrophenyl)-2-[(3S,4R)-3-hydroxy-4-pyrrolidin-1-ylpyrrolidin-1-yl]-2-phenylacetamide.
| Compound Name | (2S)-N-(4-chloro-3-nitrophenyl)-2-[(3S,4R)-3-hydroxy-4-pyrrolidin-1-ylpyrrolidin-1-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 124866133 |
| Molecular Formula | C22H25ClN4O4 |
| Molecular Weight | 444.92 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | (2S)-N-(4-chloro-3-nitrophenyl)-2-[(3S,4R)-3-hydroxy-4-pyrrolidin-1-ylpyrrolidin-1-yl]-2-phenylacetamide |
| SMILES | O=C(Nc1ccc(Cl)c([N+](=O)[O-])c1)[C@H](c1ccccc1)N1C[C@@H](N2CCCC2)[C@@H](O)C1 |
| InChI | InChI=1S/C22H25ClN4O4/c23-17-9-8-16(12-18(17)27(30)31)24-22(29)21(15-6-2-1-3-7-15)26-13-19(20(28)14-26)25-10-4-5-11-25/h1-3,6-9,12,19-21,28H,4-5,10-11,13-14H2,(H,24,29)/t19-,20+,21+/m1/s1 |
| InChIKey | NHDLJRIDYZMCNR-HKBOAZHASA-N |
| XLogP | 3.07 |
| TPSA | 98.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.92 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|