C22H27N5O4S — CID 55847422
1-[4-(furan-2-ylmethyl)-5-[2-(2-nitrophenoxy)ethylsulfanyl]-1,2,4-triazol-3-yl]-3,5-dimethylpiperidine (PubChem CID 55847422) has the molecular formula C22H27N5O4S and a molecular weight of 457.56 g/mol. Its IUPAC name is 1-[4-(furan-2-ylmethyl)-5-[2-(2-nitrophenoxy)ethylsulfanyl]-1,2,4-triazol-3-yl]-3,5-dimethylpiperidine.
| Compound Name | 1-[4-(furan-2-ylmethyl)-5-[2-(2-nitrophenoxy)ethylsulfanyl]-1,2,4-triazol-3-yl]-3,5-dimethylpiperidine |
|---|---|
| PubChem CID | 55847422 |
| Molecular Formula | C22H27N5O4S |
| Molecular Weight | 457.56 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | 1-[4-(furan-2-ylmethyl)-5-[2-(2-nitrophenoxy)ethylsulfanyl]-1,2,4-triazol-3-yl]-3,5-dimethylpiperidine |
| SMILES | CC1CC(C)CN(c2nnc(SCCOc3ccccc3[N+](=O)[O-])n2Cc2ccco2)C1 |
| InChI | InChI=1S/C22H27N5O4S/c1-16-12-17(2)14-25(13-16)21-23-24-22(26(21)15-18-6-5-9-30-18)32-11-10-31-20-8-4-3-7-19(20)27(28)29/h3-9,16-17H,10-15H2,1-2H3 |
| InChIKey | PDTGXOSVKOXJRY-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 99.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.56 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|